C27H37FN5O8P — CID 156835921
3,3-dimethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835921) has the molecular formula C27H37FN5O8P and a molecular weight of 609.59 g/mol. Its IUPAC name is 3,3-dimethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 3,3-dimethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835921 |
| Molecular Formula | C27H37FN5O8P |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 3,3-dimethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@]1(CF)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C27H37FN5O8P/c1-17(25(36)38-13-12-26(2,3)4)32-42(37,41-18-8-6-5-7-9-18)39-15-27(14-28)23(35)21(34)22(40-27)19-10-11-20-24(29)30-16-31-33(19)20/h5-11,16-17,21-23,34-35H,12-15H2,1-4H3,(H,32,37)(H2,29,30,31)/t17-,21-,22-,23-,27+,42?/m0/s1 |
| InChIKey | GINWCVKOHVVXKZ-KAEGLTQWSA-N |
| XLogP | 2.97 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|