C26H34FN6O8P — CID 165390910
(1-methylpyrrolidin-3-yl) (2R)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 165390910) has the molecular formula C26H34FN6O8P and a molecular weight of 608.56 g/mol. Its IUPAC name is (1-methylpyrrolidin-3-yl) (2R)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | (1-methylpyrrolidin-3-yl) (2R)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 165390910 |
| Molecular Formula | C26H34FN6O8P |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | (1-methylpyrrolidin-3-yl) (2R)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@@H](NP(=O)(OC[C@@]1(CF)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OC1CCN(C)C1 |
| InChI | InChI=1S/C26H34FN6O8P/c1-16(25(36)39-18-10-11-32(2)12-18)31-42(37,41-17-6-4-3-5-7-17)38-14-26(13-27)23(35)21(34)22(40-26)19-8-9-20-24(28)29-15-30-33(19)20/h3-9,15-16,18,21-23,34-35H,10-14H2,1-2H3,(H,31,37)(H2,28,29,30)/t16-,18?,21+,22+,23+,26-,42?/m1/s1 |
| InChIKey | PCGYDMLOWWOWRG-YJPASCCKSA-N |
| XLogP | 1.24 |
| TPSA | 183.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|