C27H37FN5O8P — CID 158087354
ethyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate (PubChem CID 158087354) has the molecular formula C27H37FN5O8P and a molecular weight of 609.59 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 158087354 |
| Molecular Formula | C27H37FN5O8P |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N[P@@](=O)(OC[C@@]1(CF)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H37FN5O8P/c1-6-38-25(36)16(2)32-42(37,41-18-9-7-17(8-10-18)26(3,4)5)39-14-27(13-28)23(35)21(34)22(40-27)19-11-12-20-24(29)30-15-31-33(19)20/h7-12,15-16,21-23,34-35H,6,13-14H2,1-5H3,(H,32,37)(H2,29,30,31)/t16-,21-,22-,23-,27+,42+/m0/s1 |
| InChIKey | GHVWCGUFRKZIPO-HEKXWMFLSA-N |
| XLogP | 2.86 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|