C31H43FN5O9P — CID 156835841
2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835841) has the molecular formula C31H43FN5O9P and a molecular weight of 679.68 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835841 |
| Molecular Formula | C31H43FN5O9P |
| Molecular Weight | 679.68 g/mol |
| Exact Mass | 679.28 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCC(=O)Nc1ncnn2c([C@@H]3O[C@](CF)(CO[P@@](=O)(N[C@@H](C)C(=O)OCC(CC)CC)Oc4ccccc4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C31H43FN5O9P/c1-5-11-25(38)35-29-24-15-14-23(37(24)34-19-33-29)27-26(39)28(40)31(17-32,45-27)18-44-47(42,46-22-12-9-8-10-13-22)36-20(4)30(41)43-16-21(6-2)7-3/h8-10,12-15,19-21,26-28,39-40H,5-7,11,16-18H2,1-4H3,(H,36,42)(H,33,34,35,38)/t20-,26-,27-,28-,31+,47-/m0/s1 |
| InChIKey | SVSXAEVOWJIUBS-RNBIWRNCSA-N |
| XLogP | 4.13 |
| TPSA | 182.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|