C24H31FN5O8P — CID 159518192
propyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 159518192) has the molecular formula C24H31FN5O8P and a molecular weight of 567.51 g/mol. Its IUPAC name is propyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 159518192 |
| Molecular Formula | C24H31FN5O8P |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | propyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCOC(=O)[C@H](C)N[P@@](=O)(OC[C@@]1(CF)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H31FN5O8P/c1-3-11-35-23(33)15(2)29-39(34,38-16-7-5-4-6-8-16)36-13-24(12-25)21(32)19(31)20(37-24)17-9-10-18-22(26)27-14-28-30(17)18/h4-10,14-15,19-21,31-32H,3,11-13H2,1-2H3,(H,29,34)(H2,26,27,28)/t15-,19-,20-,21-,24+,39+/m0/s1 |
| InChIKey | MBLYAMKHESKDGD-PKOSPVIESA-N |
| XLogP | 1.95 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|