C27H35FN5O8P — CID 174355667
3,3-dimethylbutyl (2S)-2-[[[(1R,3S,4S,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-fluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 174355667) has the molecular formula C27H35FN5O8P and a molecular weight of 607.58 g/mol. Its IUPAC name is 3,3-dimethylbutyl (2S)-2-[[[(1R,3S,4S,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-fluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 3,3-dimethylbutyl (2S)-2-[[[(1R,3S,4S,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-fluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 174355667 |
| Molecular Formula | C27H35FN5O8P |
| Molecular Weight | 607.58 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | 3,3-dimethylbutyl (2S)-2-[[[(1R,3S,4S,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-fluoro-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@](=O)(OC[C@@]12O[C@@H](c3ccc4c(N)ncnn34)[C@H](O)[C@@]1(O)C2F)Oc1ccccc1)C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C27H35FN5O8P/c1-16(23(35)38-13-12-25(2,3)4)32-42(37,41-17-8-6-5-7-9-17)39-14-26-24(28)27(26,36)21(34)20(40-26)18-10-11-19-22(29)30-15-31-33(18)19/h5-11,15-16,20-21,24,34,36H,12-14H2,1-4H3,(H,32,37)(H2,29,30,31)/t16-,20-,21-,24?,26-,27+,42-/m0/s1 |
| InChIKey | DQBFPQYIMPXHOZ-JVNYCMBWSA-N |
| XLogP | 2.73 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|