C26H29N6O10P — CID 161424878
methyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyanooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 161424878) has the molecular formula C26H29N6O10P and a molecular weight of 616.52 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyanooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyanooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 161424878 |
| Molecular Formula | C26H29N6O10P |
| Molecular Weight | 616.52 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyanooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)N[P@](=O)(OC[C@@]1(C#N)O[C@@H](c2ccc3c(N)ncnn23)[C@H](OC(C)=O)[C@@H]1OC(C)=O)Oc1ccccc1 |
| InChI | InChI=1S/C26H29N6O10P/c1-15(25(35)37-4)31-43(36,42-18-8-6-5-7-9-18)38-13-26(12-27)23(40-17(3)34)22(39-16(2)33)21(41-26)19-10-11-20-24(28)29-14-30-32(19)20/h5-11,14-15,21-23H,13H2,1-4H3,(H,31,36)(H2,28,29,30)/t15-,21-,22-,23-,26+,43-/m0/s1 |
| InChIKey | VXFNAEXPSNCXEY-DZIVSESFSA-N |
| XLogP | 1.86 |
| TPSA | 215.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|