C29H38N5O10P — CID 170236406
butyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170236406) has the molecular formula C29H38N5O10P and a molecular weight of 647.62 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170236406 |
| Molecular Formula | C29H38N5O10P |
| Molecular Weight | 647.62 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)N[P@](=O)(OC[C@@]1(C)O[C@@H](c2ccc3c(N)ncnn23)[C@H](OC(C)=O)[C@@H]1OC(C)=O)Oc1ccccc1 |
| InChI | InChI=1S/C29H38N5O10P/c1-6-7-15-39-28(37)18(2)33-45(38,44-21-11-9-8-10-12-21)40-16-29(5)26(42-20(4)36)25(41-19(3)35)24(43-29)22-13-14-23-27(30)31-17-32-34(22)23/h8-14,17-18,24-26H,6-7,15-16H2,1-5H3,(H,33,38)(H2,30,31,32)/t18-,24-,25-,26-,29+,45-/m0/s1 |
| InChIKey | CHFONLJOOCJZMG-CQYCCEOQSA-N |
| XLogP | 3.53 |
| TPSA | 191.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|