C31H36N5O11P — CID 170231805
oxan-4-yl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyanooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170231805) has the molecular formula C31H36N5O11P and a molecular weight of 685.63 g/mol. Its IUPAC name is oxan-4-yl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyanooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | oxan-4-yl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyanooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170231805 |
| Molecular Formula | C31H36N5O11P |
| Molecular Weight | 685.63 g/mol |
| Exact Mass | 685.21 |
| IUPAC Name | oxan-4-yl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyanooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(=O)O[C@H]1[C@H](c2ccc3c(N)ccnn23)O[C@](C#N)(CO[P@@](=O)(N[C@@H](C)C(=O)OC2CCOCC2)Oc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H36N5O11P/c1-19(30(39)45-22-12-15-41-16-13-22)35-48(40,47-23-7-5-4-6-8-23)42-18-31(17-32)29(44-21(3)38)28(43-20(2)37)27(46-31)26-10-9-25-24(33)11-14-34-36(25)26/h4-11,14,19,22,27-29H,12-13,15-16,18,33H2,1-3H3,(H,35,40)/t19-,27-,28-,29-,31+,48-/m0/s1 |
| InChIKey | NWPFTLHZCQNBLG-KVPYNDBJSA-N |
| XLogP | 3.02 |
| TPSA | 212.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|