C33H40N5O10P — CID 170231817
cyclobutylmethyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170231817) has the molecular formula C33H40N5O10P and a molecular weight of 697.68 g/mol. Its IUPAC name is cyclobutylmethyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclobutylmethyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170231817 |
| Molecular Formula | C33H40N5O10P |
| Molecular Weight | 697.68 g/mol |
| Exact Mass | 697.25 |
| IUPAC Name | cyclobutylmethyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](c2ccc3c(N)ccnn23)O[C@](C#N)(CO[P@@](=O)(N[C@@H](C)C(=O)OCC2CCC2)Oc2ccccc2)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C33H40N5O10P/c1-4-27(39)45-30-29(26-15-14-25-24(35)16-17-36-38(25)26)47-33(19-34,31(30)46-28(40)5-2)20-44-49(42,48-23-12-7-6-8-13-23)37-21(3)32(41)43-18-22-10-9-11-22/h6-8,12-17,21-22,29-31H,4-5,9-11,18,20,35H2,1-3H3,(H,37,42)/t21-,29-,30-,31-,33+,49-/m0/s1 |
| InChIKey | FTKBUBIQQZWKOT-JPCJDZNWSA-N |
| XLogP | 4.42 |
| TPSA | 202.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|