C34H43N6O10P — CID 169069224
oxan-4-ylmethyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-benzylphosphoryl]amino]propanoate (PubChem CID 169069224) has the molecular formula C34H43N6O10P and a molecular weight of 726.72 g/mol. Its IUPAC name is oxan-4-ylmethyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-benzylphosphoryl]amino]propanoate.
| Compound Name | oxan-4-ylmethyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-benzylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 169069224 |
| Molecular Formula | C34H43N6O10P |
| Molecular Weight | 726.72 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | oxan-4-ylmethyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-benzylphosphoryl]amino]propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](c2ccc3c(N)ncnn23)O[C@](C#N)(CO[P@@](=O)(Cc2ccccc2)N[C@@H](C)C(=O)OCC2CCOCC2)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C34H43N6O10P/c1-4-27(41)48-30-29(25-11-12-26-32(36)37-21-38-40(25)26)50-34(19-35,31(30)49-28(42)5-2)20-47-51(44,18-24-9-7-6-8-10-24)39-22(3)33(43)46-17-23-13-15-45-16-14-23/h6-12,21-23,29-31H,4-5,13-18,20H2,1-3H3,(H,39,44)(H2,36,37,38)/t22-,29-,30-,31-,34+,51-/m0/s1 |
| InChIKey | JMCAAHNAEGUDOO-OIEODQNFSA-N |
| XLogP | 3.65 |
| TPSA | 215.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.72 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|