C22H28N6O8 — CID 166740788
methyl (2S)-2-[[(2R,3S,4S,5S)-4-acetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-propanoyloxyoxolan-2-yl]methoxymethylamino]propanoate (PubChem CID 166740788) has the molecular formula C22H28N6O8 and a molecular weight of 504.50 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,3S,4S,5S)-4-acetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-propanoyloxyoxolan-2-yl]methoxymethylamino]propanoate.
| Compound Name | methyl (2S)-2-[[(2R,3S,4S,5S)-4-acetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-propanoyloxyoxolan-2-yl]methoxymethylamino]propanoate |
|---|---|
| PubChem CID | 166740788 |
| Molecular Formula | C22H28N6O8 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | methyl (2S)-2-[[(2R,3S,4S,5S)-4-acetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-propanoyloxyoxolan-2-yl]methoxymethylamino]propanoate |
| SMILES | CCC(=O)O[C@H]1[C@@H](OC(C)=O)[C@H](c2ccc3c(N)ncnn23)O[C@]1(C#N)COCN[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C22H28N6O8/c1-5-16(30)35-19-18(34-13(3)29)17(14-6-7-15-20(24)25-10-27-28(14)15)36-22(19,8-23)9-33-11-26-12(2)21(31)32-4/h6-7,10,12,17-19,26H,5,9,11H2,1-4H3,(H2,24,25,27)/t12-,17-,18-,19-,22+/m0/s1 |
| InChIKey | SNZLFRZEONGLBY-ANKZSNNRSA-N |
| XLogP | 0.02 |
| TPSA | 189.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|