C21H28N6O8P+ — CID 170218756
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-hydroxy-4-propanoyloxyoxolan-2-yl]methoxy-oxo-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphanium (PubChem CID 170218756) has the molecular formula C21H28N6O8P+ and a molecular weight of 523.46 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-hydroxy-4-propanoyloxyoxolan-2-yl]methoxy-oxo-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphanium.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-hydroxy-4-propanoyloxyoxolan-2-yl]methoxy-oxo-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphanium |
|---|---|
| PubChem CID | 170218756 |
| Molecular Formula | C21H28N6O8P+ |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-hydroxy-4-propanoyloxyoxolan-2-yl]methoxy-oxo-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphanium |
| SMILES | CCC(=O)O[C@H]1[C@H](c2ccc3c(N)ncnn23)O[C@](C#N)(CO[P+](=O)N[C@@H](C)C(=O)OC(C)C)[C@H]1O |
| InChI | InChI=1S/C21H28N6O8P/c1-5-15(28)34-17-16(13-6-7-14-19(23)24-10-25-27(13)14)35-21(8-22,18(17)29)9-32-36(31)26-12(4)20(30)33-11(2)3/h6-7,10-12,16-18,29H,5,9H2,1-4H3,(H,26,31)(H2,23,24,25)/q+1/t12-,16-,17-,18-,21+/m0/s1 |
| InChIKey | DWHHERSZHVLHJX-PCKVSMSNSA-N |
| XLogP | 0.93 |
| TPSA | 200.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|