C23H30N6O7P+ — CID 166740529
[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-propanoyloxyoxolan-2-yl]methoxy-[[(2S)-1-(cyclobutylmethoxy)-1-oxopropan-2-yl]amino]-oxophosphanium (PubChem CID 166740529) has the molecular formula C23H30N6O7P+ and a molecular weight of 533.50 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-propanoyloxyoxolan-2-yl]methoxy-[[(2S)-1-(cyclobutylmethoxy)-1-oxopropan-2-yl]amino]-oxophosphanium.
| Compound Name | [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-propanoyloxyoxolan-2-yl]methoxy-[[(2S)-1-(cyclobutylmethoxy)-1-oxopropan-2-yl]amino]-oxophosphanium |
|---|---|
| PubChem CID | 166740529 |
| Molecular Formula | C23H30N6O7P+ |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3-propanoyloxyoxolan-2-yl]methoxy-[[(2S)-1-(cyclobutylmethoxy)-1-oxopropan-2-yl]amino]-oxophosphanium |
| SMILES | CCC(=O)O[C@H]1C[C@H](c2ccc3c(N)ncnn23)O[C@]1(C#N)CO[P+](=O)N[C@@H](C)C(=O)OCC1CCC1 |
| InChI | InChI=1S/C23H30N6O7P/c1-3-20(30)35-19-9-18(16-7-8-17-21(25)26-13-27-29(16)17)36-23(19,11-24)12-34-37(32)28-14(2)22(31)33-10-15-5-4-6-15/h7-8,13-15,18-19H,3-6,9-10,12H2,1-2H3,(H,28,32)(H2,25,26,27)/q+1/t14-,18+,19-,23+/m0/s1 |
| InChIKey | VAUYNAIWIYUFJB-IJFYOMKJSA-N |
| XLogP | 2.35 |
| TPSA | 180.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|