C23H34N6O6 — CID 170217659
2-ethylbutyl (2S)-2-[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxymethylamino]butanoate (PubChem CID 170217659) has the molecular formula C23H34N6O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxymethylamino]butanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxymethylamino]butanoate |
|---|---|
| PubChem CID | 170217659 |
| Molecular Formula | C23H34N6O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxymethylamino]butanoate |
| SMILES | CCC(CC)COC(=O)[C@H](CC)NCOC[C@@]1(C#N)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H34N6O6/c1-4-14(5-2)9-34-22(32)15(6-3)27-13-33-11-23(10-24)20(31)18(30)19(35-23)16-7-8-17-21(25)26-12-28-29(16)17/h7-8,12,14-15,18-20,27,30-31H,4-6,9,11,13H2,1-3H3,(H2,25,26,28)/t15-,18-,19-,20-,23+/m0/s1 |
| InChIKey | WPGSRDRATRIXQN-SDUJRDBPSA-N |
| XLogP | 0.69 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|