C18H23N5O6 — CID 169174973
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2S)-2-methylbutyl] carbonate (PubChem CID 169174973) has the molecular formula C18H23N5O6 and a molecular weight of 405.41 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2S)-2-methylbutyl] carbonate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2S)-2-methylbutyl] carbonate |
|---|---|
| PubChem CID | 169174973 |
| Molecular Formula | C18H23N5O6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2S)-2-methylbutyl] carbonate |
| SMILES | CC[C@H](C)COC(=O)OC[C@@]1(C#N)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H23N5O6/c1-3-10(2)6-27-17(26)28-8-18(7-19)15(25)13(24)14(29-18)11-4-5-12-16(20)21-9-22-23(11)12/h4-5,9-10,13-15,24-25H,3,6,8H2,1-2H3,(H2,20,21,22)/t10-,13-,14-,15-,18+/m0/s1 |
| InChIKey | MZIRABJTEAXSMY-YFKXNMLDSA-N |
| XLogP | 0.57 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |