C19H25N5O6 — CID 169174995
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methyl hexyl carbonate (PubChem CID 169174995) has the molecular formula C19H25N5O6 and a molecular weight of 419.44 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methyl hexyl carbonate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methyl hexyl carbonate |
|---|---|
| PubChem CID | 169174995 |
| Molecular Formula | C19H25N5O6 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methyl hexyl carbonate |
| SMILES | CCCCCCOC(=O)OC[C@@]1(C#N)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H25N5O6/c1-2-3-4-5-8-28-18(27)29-10-19(9-20)16(26)14(25)15(30-19)12-6-7-13-17(21)22-11-23-24(12)13/h6-7,11,14-16,25-26H,2-5,8,10H2,1H3,(H2,21,22,23)/t14-,15-,16-,19+/m0/s1 |
| InChIKey | ZGHMHRZDCUGIKL-IUVQAAGXSA-N |
| XLogP | 1.10 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|