C28H40N5O8P — CID 170217626
2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanoate (PubChem CID 170217626) has the molecular formula C28H40N5O8P and a molecular weight of 605.63 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanoate |
|---|---|
| PubChem CID | 170217626 |
| Molecular Formula | C28H40N5O8P |
| Molecular Weight | 605.63 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanoate |
| SMILES | CCC(CC)COC(=O)[C@H](CC)NP(=O)(OC[C@@]1(C)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C28H40N5O8P/c1-5-18(6-2)15-38-27(36)20(7-3)32-42(37,41-19-11-9-8-10-12-19)39-16-28(4)25(35)23(34)24(40-28)21-13-14-22-26(29)30-17-31-33(21)22/h8-14,17-18,20,23-25,34-35H,5-7,15-16H2,1-4H3,(H,32,37)(H2,29,30,31)/t20-,23-,24-,25-,28+,42?/m0/s1 |
| InChIKey | CBVLRCOJBOEOGD-CVIXODODSA-N |
| XLogP | 3.41 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|