C25H32N5O8P — CID 170218305
2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl 1-methylcyclopropane-1-carboxylate (PubChem CID 170218305) has the molecular formula C25H32N5O8P and a molecular weight of 561.53 g/mol. Its IUPAC name is 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl 1-methylcyclopropane-1-carboxylate.
| Compound Name | 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl 1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 170218305 |
| Molecular Formula | C25H32N5O8P |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl 1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCCNP(=O)(OC[C@@]2(C)O[C@@H](c3ccc4c(N)ncnn34)[C@H](O)[C@@H]2O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N5O8P/c1-24(10-11-24)23(33)35-13-12-29-39(34,38-16-6-4-3-5-7-16)36-14-25(2)21(32)19(31)20(37-25)17-8-9-18-22(26)27-15-28-30(17)18/h3-9,15,19-21,31-32H,10-14H2,1-2H3,(H,29,34)(H2,26,27,28)/t19-,20-,21-,25+,39?/m0/s1 |
| InChIKey | MQVHNPFHUBYYRM-BNSIOBEUSA-N |
| XLogP | 2.00 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|