C27H33N6O8P — CID 156835609
2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl cyclohexanecarboxylate (PubChem CID 156835609) has the molecular formula C27H33N6O8P and a molecular weight of 600.57 g/mol. Its IUPAC name is 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl cyclohexanecarboxylate.
| Compound Name | 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 156835609 |
| Molecular Formula | C27H33N6O8P |
| Molecular Weight | 600.57 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl cyclohexanecarboxylate |
| SMILES | N#C[C@]1(COP(=O)(NCCOC(=O)C2CCCCC2)Oc2ccccc2)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H33N6O8P/c28-15-27(24(35)22(34)23(40-27)20-11-12-21-25(29)30-17-31-33(20)21)16-39-42(37,41-19-9-5-2-6-10-19)32-13-14-38-26(36)18-7-3-1-4-8-18/h2,5-6,9-12,17-18,22-24,34-35H,1,3-4,7-8,13-14,16H2,(H,32,37)(H2,29,30,31)/t22-,23-,24-,27+,42?/m0/s1 |
| InChIKey | POZZYBDJAWSEGS-CMYVYFFUSA-N |
| XLogP | 2.28 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|