C30H44N5O8P — CID 156835360
2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate (PubChem CID 156835360) has the molecular formula C30H44N5O8P and a molecular weight of 633.68 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 156835360 |
| Molecular Formula | C30H44N5O8P |
| Molecular Weight | 633.68 g/mol |
| Exact Mass | 633.29 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
| SMILES | CCC(CC)COC(=O)[C@H](CC(C)C)NP(=O)(OC[C@@]1(C)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C30H44N5O8P/c1-6-20(7-2)16-40-29(38)22(15-19(3)4)34-44(39,43-21-11-9-8-10-12-21)41-17-30(5)27(37)25(36)26(42-30)23-13-14-24-28(31)32-18-33-35(23)24/h8-14,18-20,22,25-27,36-37H,6-7,15-17H2,1-5H3,(H,34,39)(H2,31,32,33)/t22-,25-,26-,27-,30+,44?/m0/s1 |
| InChIKey | VTUGAKFCBSELGP-XILPPURLSA-N |
| XLogP | 4.05 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|