C29H40N5O8P — CID 170219725
cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methylbutanoate (PubChem CID 170219725) has the molecular formula C29H40N5O8P and a molecular weight of 617.64 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methylbutanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 170219725 |
| Molecular Formula | C29H40N5O8P |
| Molecular Weight | 617.64 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NP(=O)(OC[C@@]1(C)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C29H40N5O8P/c1-18(2)23(28(37)40-19-10-6-4-7-11-19)33-43(38,42-20-12-8-5-9-13-20)39-16-29(3)26(36)24(35)25(41-29)21-14-15-22-27(30)31-17-32-34(21)22/h5,8-9,12-15,17-19,23-26,35-36H,4,6-7,10-11,16H2,1-3H3,(H,33,38)(H2,30,31,32)/t23-,24-,25-,26-,29+,43?/m0/s1 |
| InChIKey | WULKNMZUFRXYOU-XKFCKYLOSA-N |
| XLogP | 3.56 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|