C17H25N5O4 — CID 166740422
methyl (2S)-2-[[(2S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxymethylamino]propanoate (PubChem CID 166740422) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxymethylamino]propanoate.
| Compound Name | methyl (2S)-2-[[(2S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxymethylamino]propanoate |
|---|---|
| PubChem CID | 166740422 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | methyl (2S)-2-[[(2S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methyloxolan-2-yl]methoxymethylamino]propanoate |
| SMILES | COC(=O)[C@H](C)NCOC[C@]1(C)CC[C@H](c2ccc3c(N)ncnn23)O1 |
| InChI | InChI=1S/C17H25N5O4/c1-11(16(23)24-3)20-10-25-8-17(2)7-6-14(26-17)12-4-5-13-15(18)19-9-21-22(12)13/h4-5,9,11,14,20H,6-8,10H2,1-3H3,(H2,18,19,21)/t11-,14+,17-/m0/s1 |
| InChIKey | XOBZLSBRASNFGE-KHIZAZIESA-N |
| XLogP | 1.05 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|