C19H23N5O3 — CID 169174649
[(2R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyanooxolan-2-yl]methyl 3,3-dimethylcyclobutane-1-carboxylate (PubChem CID 169174649) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is [(2R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyanooxolan-2-yl]methyl 3,3-dimethylcyclobutane-1-carboxylate.
| Compound Name | [(2R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyanooxolan-2-yl]methyl 3,3-dimethylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 169174649 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | [(2R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyanooxolan-2-yl]methyl 3,3-dimethylcyclobutane-1-carboxylate |
| SMILES | CC1(C)CC(C(=O)OC[C@]2(C#N)CC[C@H](c3ccc4c(N)ncnn34)O2)C1 |
| InChI | InChI=1S/C19H23N5O3/c1-18(2)7-12(8-18)17(25)26-10-19(9-20)6-5-15(27-19)13-3-4-14-16(21)22-11-23-24(13)14/h3-4,11-12,15H,5-8,10H2,1-2H3,(H2,21,22,23)/t15-,19-/m1/s1 |
| InChIKey | GUHKXBHQVFFUAA-DNVCBOLYSA-N |
| XLogP | 2.40 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |