C24H33N5O4 — CID 169174451
[(2R,5R)-2-cyano-5-[4-(3,3-dimethylbutanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 3,3-dimethylbutanoate (PubChem CID 169174451) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is [(2R,5R)-2-cyano-5-[4-(3,3-dimethylbutanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 3,3-dimethylbutanoate.
| Compound Name | [(2R,5R)-2-cyano-5-[4-(3,3-dimethylbutanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 169174451 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | [(2R,5R)-2-cyano-5-[4-(3,3-dimethylbutanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)Nc1ncnn2c([C@H]3CC[C@@](C#N)(COC(=O)CC(C)(C)C)O3)ccc12 |
| InChI | InChI=1S/C24H33N5O4/c1-22(2,3)11-19(30)28-21-17-8-7-16(29(17)27-15-26-21)18-9-10-24(13-25,33-18)14-32-20(31)12-23(4,5)6/h7-8,15,18H,9-12,14H2,1-6H3,(H,26,27,28,30)/t18-,24-/m1/s1 |
| InChIKey | SNBRPVBDYAHNOV-HOYKHHGWSA-N |
| XLogP | 4.20 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |