C22H33N6O7P — CID 145277843
ethyl (2S)-2-[[[(2R,3R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-oxaspiro[2.4]heptan-2-yl]oxy-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate (PubChem CID 145277843) has the molecular formula C22H33N6O7P and a molecular weight of 524.52 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-oxaspiro[2.4]heptan-2-yl]oxy-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-oxaspiro[2.4]heptan-2-yl]oxy-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 145277843 |
| Molecular Formula | C22H33N6O7P |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-oxaspiro[2.4]heptan-2-yl]oxy-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(N[C@@H](C)C(=O)OCC)O[C@@H]1C[C@]12CC[C@H](c1ccc3c(N)ncnn13)O2 |
| InChI | InChI=1S/C22H33N6O7P/c1-5-32-20(29)13(3)26-36(31,27-14(4)21(30)33-6-2)35-18-11-22(18)10-9-17(34-22)15-7-8-16-19(23)24-12-25-28(15)16/h7-8,12-14,17-18H,5-6,9-11H2,1-4H3,(H2,23,24,25)(H2,26,27,31)/t13-,14-,17+,18+,22+/m0/s1 |
| InChIKey | YUQXDFUWHGPEFG-PLODJGGBSA-N |
| XLogP | 1.88 |
| TPSA | 168.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|