C17H26N4O6 — CID 169174248
[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl ethyl carbonate;propane-1,1-diol (PubChem CID 169174248) has the molecular formula C17H26N4O6 and a molecular weight of 382.42 g/mol. Its IUPAC name is [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl ethyl carbonate;propane-1,1-diol.
| Compound Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl ethyl carbonate;propane-1,1-diol |
|---|---|
| PubChem CID | 169174248 |
| Molecular Formula | C17H26N4O6 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl ethyl carbonate;propane-1,1-diol |
| SMILES | CCC(O)O.CCOC(=O)OCC1CCC(c2ccc3c(N)ncnn23)O1 |
| InChI | InChI=1S/C14H18N4O4.C3H8O2/c1-2-20-14(19)21-7-9-3-6-12(22-9)10-4-5-11-13(15)16-8-17-18(10)11;1-2-3(4)5/h4-5,8-9,12H,2-3,6-7H2,1H3,(H2,15,16,17);3-5H,2H2,1H3 |
| InChIKey | NKGWSJRUEHDFGR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|