C24H35N5O8 — CID 169174211
[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl propan-2-yl carbonate;formonitrile;octanedioic acid (PubChem CID 169174211) has the molecular formula C24H35N5O8 and a molecular weight of 521.57 g/mol. Its IUPAC name is [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl propan-2-yl carbonate;formonitrile;octanedioic acid.
| Compound Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl propan-2-yl carbonate;formonitrile;octanedioic acid |
|---|---|
| PubChem CID | 169174211 |
| Molecular Formula | C24H35N5O8 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl propan-2-yl carbonate;formonitrile;octanedioic acid |
| SMILES | C#N.CC(C)OC(=O)OCC1CCC(c2ccc3c(N)ncnn23)O1.O=C(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C15H20N4O4.C8H14O4.CHN/c1-9(2)22-15(20)21-7-10-3-6-13(23-10)11-4-5-12-14(16)17-8-18-19(11)12;9-7(10)5-3-1-2-4-6-8(11)12;1-2/h4-5,8-10,13H,3,6-7H2,1-2H3,(H2,16,17,18);1-6H2,(H,9,10)(H,11,12);1H |
| InChIKey | ULNPZPWRSHMRQD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 199.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|