C26H39N5O8 — CID 172567826
[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl 2-ethylbutyl carbonate;3,3-dimethylpentanedioic acid;formonitrile (PubChem CID 172567826) has the molecular formula C26H39N5O8 and a molecular weight of 549.63 g/mol. Its IUPAC name is [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl 2-ethylbutyl carbonate;3,3-dimethylpentanedioic acid;formonitrile.
| Compound Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl 2-ethylbutyl carbonate;3,3-dimethylpentanedioic acid;formonitrile |
|---|---|
| PubChem CID | 172567826 |
| Molecular Formula | C26H39N5O8 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl 2-ethylbutyl carbonate;3,3-dimethylpentanedioic acid;formonitrile |
| SMILES | C#N.CC(C)(CC(=O)O)CC(=O)O.CCC(CC)COC(=O)OCC1CCC(c2ccc3c(N)ncnn23)O1 |
| InChI | InChI=1S/C18H26N4O4.C7H12O4.CHN/c1-3-12(4-2)9-24-18(23)25-10-13-5-8-16(26-13)14-6-7-15-17(19)20-11-21-22(14)15;1-7(2,3-5(8)9)4-6(10)11;1-2/h6-7,11-13,16H,3-5,8-10H2,1-2H3,(H2,19,20,21);3-4H2,1-2H3,(H,8,9)(H,10,11);1H |
| InChIKey | BCCNEKMWGJTZGF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 199.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |