C19H30N5O4P — CID 166862258
2-ethylbutyl 2-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxyphosphanylamino]acetate (PubChem CID 166862258) has the molecular formula C19H30N5O4P and a molecular weight of 423.45 g/mol. Its IUPAC name is 2-ethylbutyl 2-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxyphosphanylamino]acetate.
| Compound Name | 2-ethylbutyl 2-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxyphosphanylamino]acetate |
|---|---|
| PubChem CID | 166862258 |
| Molecular Formula | C19H30N5O4P |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-ethylbutyl 2-[[(5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxyphosphanylamino]acetate |
| SMILES | CCC(CC)COC(=O)CNPOCC1CC[C@H](c2ccc3c(N)ncnn23)O1 |
| InChI | InChI=1S/C19H30N5O4P/c1-3-13(4-2)10-26-18(25)9-23-29-27-11-14-5-8-17(28-14)15-6-7-16-19(20)21-12-22-24(15)16/h6-7,12-14,17,23,29H,3-5,8-11H2,1-2H3,(H2,20,21,22)/t14?,17-/m1/s1 |
| InChIKey | TUHYMSGGTWFION-FBMWCMRBSA-N |
| XLogP | 2.63 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|