C11H15N4O5P — CID 142386433
[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 142386433) has the molecular formula C11H15N4O5P and a molecular weight of 314.24 g/mol. Its IUPAC name is [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 142386433 |
| Molecular Formula | C11H15N4O5P |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1ncnn2c(C3CCC(COP(=O)(O)O)O3)ccc12 |
| InChI | InChI=1S/C11H15N4O5P/c12-11-9-3-2-8(15(9)14-6-13-11)10-4-1-7(20-10)5-19-21(16,17)18/h2-3,6-7,10H,1,4-5H2,(H2,12,13,14)(H2,16,17,18) |
| InChIKey | ASKNBHNIXBASGM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|