C13H15N4O6P — CID 142797271
[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 142797271) has the molecular formula C13H15N4O6P and a molecular weight of 354.26 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 142797271 |
| Molecular Formula | C13H15N4O6P |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C#C[C@]1(COP(=O)(O)O)O[C@@H](c2ccc3c(N)ncnn23)C[C@@H]1O |
| InChI | InChI=1S/C13H15N4O6P/c1-2-13(6-22-24(19,20)21)11(18)5-10(23-13)8-3-4-9-12(14)15-7-16-17(8)9/h1,3-4,7,10-11,18H,5-6H2,(H2,14,15,16)(H2,19,20,21)/t10-,11+,13-/m1/s1 |
| InChIKey | LXDXRMAYBICKFT-NTZNESFSSA-N |
| XLogP | -0.38 |
| TPSA | 152.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|