C12H27N4O15P3 — CID 175366891
(2S,3R,4R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-methyloxolane-3,4-diol;methane;phosphoric acid (PubChem CID 175366891) has the molecular formula C12H27N4O15P3 and a molecular weight of 560.28 g/mol. Its IUPAC name is (2S,3R,4R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-methyloxolane-3,4-diol;methane;phosphoric acid.
| Compound Name | (2S,3R,4R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-methyloxolane-3,4-diol;methane;phosphoric acid |
|---|---|
| PubChem CID | 175366891 |
| Molecular Formula | C12H27N4O15P3 |
| Molecular Weight | 560.28 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | (2S,3R,4R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-methyloxolane-3,4-diol;methane;phosphoric acid |
| SMILES | C.C[C@@]1(O)[C@H](O)CO[C@H]1c1ccc2c(N)ncnn12.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C11H14N4O3.CH4.3H3O4P/c1-11(17)8(16)4-18-9(11)6-2-3-7-10(12)13-5-14-15(6)7;;3*1-5(2,3)4/h2-3,5,8-9,16-17H,4H2,1H3,(H2,12,13,14);1H4;3*(H3,1,2,3,4)/t8-,9+,11-;;;;/m1..../s1 |
| InChIKey | BAUDBTQNTUXAJK-ZTHAZEFXSA-N |
| XLogP | -2.65 |
| TPSA | 339.18 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.28 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|