C12H15N7O3 — CID 70914673
(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-azido-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 70914673) has the molecular formula C12H15N7O3 and a molecular weight of 305.30 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-azido-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-azido-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 70914673 |
| Molecular Formula | C12H15N7O3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-azido-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@@]1(N=[N+]=[N-])[C@H](O)[C@@H](CO)O[C@H]1c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C12H15N7O3/c1-12(17-18-14)9(21)8(4-20)22-10(12)6-2-3-7-11(13)15-5-16-19(6)7/h2-3,5,8-10,20-21H,4H2,1H3,(H2,13,15,16)/t8-,9-,10+,12-/m1/s1 |
| InChIKey | IRRPQPJGOSCZDH-MWGHHZFTSA-N |
| XLogP | 0.17 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|