C13H13FIN7O3 — CID 138584207
[(2S,3R,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-4-fluoro-2-(iodomethyl)oxolan-3-yl] acetate (PubChem CID 138584207) has the molecular formula C13H13FIN7O3 and a molecular weight of 461.20 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-4-fluoro-2-(iodomethyl)oxolan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-4-fluoro-2-(iodomethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 138584207 |
| Molecular Formula | C13H13FIN7O3 |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | [(2S,3R,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-4-fluoro-2-(iodomethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](F)[C@H](c2ccc3c(N)ncnn23)O[C@@]1(CI)N=[N+]=[N-] |
| InChI | InChI=1S/C13H13FIN7O3/c1-6(23)24-11-9(14)10(25-13(11,4-15)20-21-17)7-2-3-8-12(16)18-5-19-22(7)8/h2-3,5,9-11H,4H2,1H3,(H2,16,18,19)/t9-,10-,11-,13+/m0/s1 |
| InChIKey | FOZKQCMPIAHPHE-MRBYEJRBSA-N |
| XLogP | 2.09 |
| TPSA | 140.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|