C11H14F2N7O12P3 — CID 134177490
[[(3R,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 134177490) has the molecular formula C11H14F2N7O12P3 and a molecular weight of 567.19 g/mol. Its IUPAC name is [[(3R,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3R,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 134177490 |
| Molecular Formula | C11H14F2N7O12P3 |
| Molecular Weight | 567.19 g/mol |
| Exact Mass | 566.99 |
| IUPAC Name | [[(3R,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NC1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](c2cc(F)c3c(N)ncnn23)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C11H14F2N7O12P3/c12-4-1-5(20-7(4)10(14)16-3-17-20)8-6(13)9(21)11(30-8,18-19-15)2-29-34(25,26)32-35(27,28)31-33(22,23)24/h1,3,6,8-9,21H,2H2,(H,25,26)(H,27,28)(H2,14,16,17)(H2,22,23,24)/t6-,8-,9-,11?/m0/s1 |
| InChIKey | BGUMNZGSJWBUKR-FTYVMKCISA-N |
| XLogP | 0.57 |
| TPSA | 294.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|