C11H15FN7O12P3 — CID 138598924
[[(3S,5R)-5-(4-amino-2-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 138598924) has the molecular formula C11H15FN7O12P3 and a molecular weight of 549.20 g/mol. Its IUPAC name is [[(3S,5R)-5-(4-amino-2-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3S,5R)-5-(4-amino-2-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 138598924 |
| Molecular Formula | C11H15FN7O12P3 |
| Molecular Weight | 549.20 g/mol |
| Exact Mass | 549.00 |
| IUPAC Name | [[(3S,5R)-5-(4-amino-2-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=NC1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](c2ccc3c(N)nc(F)nn23)C[C@@H]1O |
| InChI | InChI=1S/C11H15FN7O12P3/c12-10-15-9(13)6-2-1-5(19(6)16-10)7-3-8(20)11(29-7,17-18-14)4-28-33(24,25)31-34(26,27)30-32(21,22)23/h1-2,7-8,20H,3-4H2,(H,24,25)(H,26,27)(H2,13,15,16)(H2,21,22,23)/t7-,8+,11?/m1/s1 |
| InChIKey | GIDUERSVYSZALN-IXIJJPBFSA-N |
| XLogP | 0.62 |
| TPSA | 294.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|