C10H16FN6O12P3 — CID 90247899
[[(2R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-2-fluoro-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90247899) has the molecular formula C10H16FN6O12P3 and a molecular weight of 524.19 g/mol. Its IUPAC name is [[(2R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-2-fluoro-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-2-fluoro-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90247899 |
| Molecular Formula | C10H16FN6O12P3 |
| Molecular Weight | 524.19 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | [[(2R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-azido-2-fluoro-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(N=[N+]=[N-])C[C@@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H16FN6O12P3/c1-9(15-16-13)4-10(11,27-7(9)17-3-2-6(12)14-8(17)18)5-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,7H,4-5H2,1H3,(H,22,23)(H,24,25)(H2,12,14,18)(H2,19,20,21)/t7-,9-,10+/m1/s1 |
| InChIKey | MZIOELXOTQMILY-QNSHHTMESA-N |
| XLogP | 0.82 |
| TPSA | 278.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|