C11H16F2N3O13P3 — CID 147405644
[(1R,3R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-1-ethyl-4,4-difluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 147405644) has the molecular formula C11H16F2N3O13P3 and a molecular weight of 529.18 g/mol. Its IUPAC name is [(1R,3R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-1-ethyl-4,4-difluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(1R,3R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-1-ethyl-4,4-difluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 147405644 |
| Molecular Formula | C11H16F2N3O13P3 |
| Molecular Weight | 529.18 g/mol |
| Exact Mass | 528.99 |
| IUPAC Name | [(1R,3R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-1-ethyl-4,4-difluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | CC[C@]12O[C@@H](n3ccc(N)nc3=O)C(F)(F)[C@@]1(O)C2OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H16F2N3O13P3/c1-2-9-6(27-31(22,23)29-32(24,25)28-30(19,20)21)10(9,18)11(12,13)7(26-9)16-4-3-5(14)15-8(16)17/h3-4,6-7,18H,2H2,1H3,(H,22,23)(H,24,25)(H2,14,15,17)(H2,19,20,21)/t6?,7-,9-,10-/m1/s1 |
| InChIKey | DPPPAWPXDHCJIH-SQEFBNQBSA-N |
| XLogP | -0.41 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.18 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|