C11H19FN3O13P3 — CID 118612394
[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(fluoromethyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118612394) has the molecular formula C11H19FN3O13P3 and a molecular weight of 513.20 g/mol. Its IUPAC name is [[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(fluoromethyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(fluoromethyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118612394 |
| Molecular Formula | C11H19FN3O13P3 |
| Molecular Weight | 513.20 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | [[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(fluoromethyl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@H]1[C@H](n2ccc(N)nc2=O)O[C@](CF)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C11H19FN3O13P3/c1-6-8(16)11(4-12,26-9(6)15-3-2-7(13)14-10(15)17)5-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-3,6,8-9,16H,4-5H2,1H3,(H,21,22)(H,23,24)(H2,13,14,17)(H2,18,19,20)/t6-,8-,9+,11+/m0/s1 |
| InChIKey | YUJWBVCPZPQAQU-WGNDUZGJSA-N |
| XLogP | -0.60 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|