C10H15ClFN3O10P2 — CID 118595882
[(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 118595882) has the molecular formula C10H15ClFN3O10P2 and a molecular weight of 453.64 g/mol. Its IUPAC name is [(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118595882 |
| Molecular Formula | C10H15ClFN3O10P2 |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | [(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | Nc1ccn(C2O[C@](CCl)(COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2F)c(=O)n1 |
| InChI | InChI=1S/C10H15ClFN3O10P2/c11-3-10(4-23-27(21,22)25-26(18,19)20)7(16)6(12)8(24-10)15-2-1-5(13)14-9(15)17/h1-2,6-8,16H,3-4H2,(H,21,22)(H2,13,14,17)(H2,18,19,20)/t6-,7+,8?,10-/m1/s1 |
| InChIKey | OKKQQQHBBOZIJY-KIUGWDQWSA-N |
| XLogP | -0.74 |
| TPSA | 203.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|