C12H20ClFN3O12P3 — CID 118489690
1-[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]propan-2-yl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 118489690) has the molecular formula C12H20ClFN3O12P3 and a molecular weight of 545.67 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]propan-2-yl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | 1-[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]propan-2-yl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 118489690 |
| Molecular Formula | C12H20ClFN3O12P3 |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluoro-3-hydroxyoxolan-2-yl]propan-2-yl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | CC(C[C@@]1(CCl)O[C@@H](n2ccc(N)nc2=O)[C@H](F)[C@@H]1O)P(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H20ClFN3O12P3/c1-6(30(20,21)28-32(25,26)29-31(22,23)24)4-12(5-13)9(18)8(14)10(27-12)17-3-2-7(15)16-11(17)19/h2-3,6,8-10,18H,4-5H2,1H3,(H,20,21)(H,25,26)(H2,15,16,19)(H2,22,23,24)/t6?,8-,9+,10-,12+/m1/s1 |
| InChIKey | AGCLNDYXMOKIJQ-LESIENFJSA-N |
| XLogP | 0.22 |
| TPSA | 240.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|