C12H20ClFN3O11P3 — CID 123339899
[2-[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)oxolan-2-yl]-1-fluoropropyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 123339899) has the molecular formula C12H20ClFN3O11P3 and a molecular weight of 529.68 g/mol. Its IUPAC name is [2-[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)oxolan-2-yl]-1-fluoropropyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | [2-[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)oxolan-2-yl]-1-fluoropropyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 123339899 |
| Molecular Formula | C12H20ClFN3O11P3 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | [2-[5-(4-amino-2-oxopyrimidin-1-yl)-2-(chloromethyl)oxolan-2-yl]-1-fluoropropyl]-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | CC(C(F)P(=O)(O)OP(=O)(O)OP(=O)(O)O)C1(CCl)CCC(n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C12H20ClFN3O11P3/c1-7(10(14)29(19,20)27-31(24,25)28-30(21,22)23)12(6-13)4-2-9(26-12)17-5-3-8(15)16-11(17)18/h3,5,7,9-10H,2,4,6H2,1H3,(H,19,20)(H,24,25)(H2,15,16,18)(H2,21,22,23) |
| InChIKey | ZGUWTENOOGNYJA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 220.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|