C13H18ClFN3O5P — CID 147125428
4-amino-1-[(2R,5S)-5-(chloromethyl)-5-[(Z)-2-dimethoxyphosphoryl-2-fluoroethenyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 147125428) has the molecular formula C13H18ClFN3O5P and a molecular weight of 381.73 g/mol. Its IUPAC name is 4-amino-1-[(2R,5S)-5-(chloromethyl)-5-[(Z)-2-dimethoxyphosphoryl-2-fluoroethenyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5S)-5-(chloromethyl)-5-[(Z)-2-dimethoxyphosphoryl-2-fluoroethenyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 147125428 |
| Molecular Formula | C13H18ClFN3O5P |
| Molecular Weight | 381.73 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-amino-1-[(2R,5S)-5-(chloromethyl)-5-[(Z)-2-dimethoxyphosphoryl-2-fluoroethenyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | COP(=O)(OC)/C(F)=C\[C@]1(CCl)CC[C@H](n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C13H18ClFN3O5P/c1-21-24(20,22-2)9(15)7-13(8-14)5-3-11(23-13)18-6-4-10(16)17-12(18)19/h4,6-7,11H,3,5,8H2,1-2H3,(H2,16,17,19)/b9-7-/t11-,13+/m1/s1 |
| InChIKey | BPEHMMLVHQOQCU-YIGWZEFJSA-N |
| XLogP | 2.41 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|