C9H14N3O6P — CID 24763733
[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]oxymethylphosphonic acid (PubChem CID 24763733) has the molecular formula C9H14N3O6P and a molecular weight of 291.20 g/mol. Its IUPAC name is [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 24763733 |
| Molecular Formula | C9H14N3O6P |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]oxymethylphosphonic acid |
| SMILES | Nc1ccn([C@H]2CC[C@@H](OCP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O6P/c10-6-3-4-12(9(13)11-6)7-1-2-8(18-7)17-5-19(14,15)16/h3-4,7-8H,1-2,5H2,(H2,10,11,13)(H2,14,15,16)/t7-,8+/m1/s1 |
| InChIKey | WIGROQQKRSTYMS-SFYZADRCSA-N |
| XLogP | -0.39 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|