C10H17N3O4 — CID 142192944
4-amino-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;methanol (PubChem CID 142192944) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-amino-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;methanol.
| Compound Name | 4-amino-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;methanol |
|---|---|
| PubChem CID | 142192944 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 4-amino-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;methanol |
| SMILES | CO.Nc1ccn(C2CCC(CO)O2)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O3.CH4O/c10-7-3-4-12(9(14)11-7)8-2-1-6(5-13)15-8;1-2/h3-4,6,8,13H,1-2,5H2,(H2,10,11,14);2H,1H3 |
| InChIKey | STAAFCOYDHGLHB-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |