C12H21N3O4 — CID 169201542
4-(dimethylamino)-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;methanol (PubChem CID 169201542) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;methanol.
| Compound Name | 4-(dimethylamino)-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;methanol |
|---|---|
| PubChem CID | 169201542 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 4-(dimethylamino)-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;methanol |
| SMILES | CN(C)c1ccn(C2CCC(CO)O2)c(=O)n1.CO |
| InChI | InChI=1S/C11H17N3O3.CH4O/c1-13(2)9-5-6-14(11(16)12-9)10-4-3-8(7-15)17-10;1-2/h5-6,8,10,15H,3-4,7H2,1-2H3;2H,1H3 |
| InChIKey | YIFCFHIXHKMNJE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |