C12H15FN2O4 — CID 167445812
4-ethynoxy-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;fluoromethane (PubChem CID 167445812) has the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. Its IUPAC name is 4-ethynoxy-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;fluoromethane.
| Compound Name | 4-ethynoxy-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;fluoromethane |
|---|---|
| PubChem CID | 167445812 |
| Molecular Formula | C12H15FN2O4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-ethynoxy-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;fluoromethane |
| SMILES | C#COc1ccn(C2CCC(CO)O2)c(=O)n1.CF |
| InChI | InChI=1S/C11H12N2O4.CH3F/c1-2-16-9-5-6-13(11(15)12-9)10-4-3-8(7-14)17-10;1-2/h1,5-6,8,10,14H,3-4,7H2;1H3 |
| InChIKey | IDOPMTNKPSPVEK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|