C11H18FN3O3 — CID 160959975
4-amino-5-fluoro-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;ethane (PubChem CID 160959975) has the molecular formula C11H18FN3O3 and a molecular weight of 259.28 g/mol. Its IUPAC name is 4-amino-5-fluoro-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;ethane.
| Compound Name | 4-amino-5-fluoro-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;ethane |
|---|---|
| PubChem CID | 160959975 |
| Molecular Formula | C11H18FN3O3 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-amino-5-fluoro-1-[5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;ethane |
| SMILES | CC.Nc1nc(=O)n(C2CCC(CO)O2)cc1F |
| InChI | InChI=1S/C9H12FN3O3.C2H6/c10-6-3-13(9(15)12-8(6)11)7-2-1-5(4-14)16-7;1-2/h3,5,7,14H,1-2,4H2,(H2,11,12,15);1-2H3 |
| InChIKey | SWWRFMQQPJTTAP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |