C9H12FN3O3S — CID 137477470
4-amino-5-fluoro-1-[(2R,4S,5R)-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]pyrimidin-2-one (PubChem CID 137477470) has the molecular formula C9H12FN3O3S and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-amino-5-fluoro-1-[(2R,4S,5R)-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-fluoro-1-[(2R,4S,5R)-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 137477470 |
| Molecular Formula | C9H12FN3O3S |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-amino-5-fluoro-1-[(2R,4S,5R)-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@H]2C[C@H](S)[C@@H](CO)O2)cc1F |
| InChI | InChI=1S/C9H12FN3O3S/c10-4-2-13(9(15)12-8(4)11)7-1-6(17)5(3-14)16-7/h2,5-7,14,17H,1,3H2,(H2,11,12,15)/t5-,6+,7-/m1/s1 |
| InChIKey | NYZLBXLWBYSAIS-DSYKOEDSSA-N |
| XLogP | -0.46 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|